9-oxofluorene-2,7-dicarboxylic acid

C15H8O5 — CID 2758945

IUPAC9-oxofluorene-2,7-dicarboxylic acid
SMILESO=C(O)c1ccc2c(c1)C(=O)c1cc(C(=O)O)ccc1-2
InChIInChI=1S/C15H8O5/c16-13-11-5-7(14(17)18)1-3-9(11)10-4-2-8(15(19)20)6-12(10)13/h1-6H,(H,17,18)(H,19,20)
InChIKeyXMIFYVJZYNTBTI-UHFFFAOYSA-N
MW268.22 g/mol
LogP2.29
Rot. Bonds2

About 9-oxofluorene-2,7-dicarboxylic acid

9-oxofluorene-2,7-dicarboxylic acid (PubChem CID 2758945) has the molecular formula C15H8O5 and a molecular weight of 268.22 g/mol. Its IUPAC name is 9-oxofluorene-2,7-dicarboxylic acid.

Molecular Properties

Compound Name9-oxofluorene-2,7-dicarboxylic acid
PubChem CID2758945
Molecular FormulaC15H8O5
Molecular Weight268.22 g/mol
Exact Mass268.04
IUPAC Name9-oxofluorene-2,7-dicarboxylic acid
SMILESO=C(O)c1ccc2c(c1)C(=O)c1cc(C(=O)O)ccc1-2
InChIInChI=1S/C15H8O5/c16-13-11-5-7(14(17)18)1-3-9(11)10-4-2-8(15(19)20)6-12(10)13/h1-6H,(H,17,18)(H,19,20)
InChIKeyXMIFYVJZYNTBTI-UHFFFAOYSA-N
XLogP2.29
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.22
LogP ≤ 52.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 9-oxofluorene-2,7-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-oxofluorene-2,7-dicarboxylic acid?
The IUPAC name of 9-oxofluorene-2,7-dicarboxylic acid (CID 2758945) is 9-oxofluorene-2,7-dicarboxylic acid.
What is the SMILES notation for 9-oxofluorene-2,7-dicarboxylic acid?
The canonical SMILES for 9-oxofluorene-2,7-dicarboxylic acid is O=C(O)c1ccc2c(c1)C(=O)c1cc(C(=O)O)ccc1-2.
What is the InChIKey of 9-oxofluorene-2,7-dicarboxylic acid?
The InChIKey is XMIFYVJZYNTBTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8O5/c16-13-11-5-7(14(17)18)1-3-9(11)10-4-2-8(15(19)20)6-12(10)13/h1-6H,(H,17,18)(H,19,20).
What are the key properties of 9-oxofluorene-2,7-dicarboxylic acid?
9-oxofluorene-2,7-dicarboxylic acid has a molecular weight of 268.22 g/mol, XLogP of 2.29, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxofluorene-2,7-dicarboxylic acid is sourced from PubChem (CID 2758945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).