C10H9FN2OS — CID 2759006
4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 2759006) has the molecular formula C10H9FN2OS and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2759006 |
| Molecular Formula | C10H9FN2OS |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2csc(N)n2)cc1F |
| InChI | InChI=1S/C10H9FN2OS/c1-14-9-3-2-6(4-7(9)11)8-5-15-10(12)13-8/h2-5H,1H3,(H2,12,13) |
| InChIKey | YNGDDNXKDDLUAK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |