About 4-formylbenzenesulfonyl chloride
4-formylbenzenesulfonyl chloride (PubChem CID 2759210) has the molecular formula C7H5ClO3S
and a molecular weight of 204.63 g/mol. Its IUPAC name is 4-formylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 4-formylbenzenesulfonyl chloride |
| PubChem CID | 2759210 |
| Molecular Formula | C7H5ClO3S |
| Molecular Weight | 204.63 g/mol |
| Exact Mass | 203.96 |
| IUPAC Name | 4-formylbenzenesulfonyl chloride |
| SMILES | O=Cc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C7H5ClO3S/c8-12(10,11)7-3-1-6(5-9)2-4-7/h1-5H |
| InChIKey | MSWSPWGBDIQKKR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.63 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-formylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formylbenzenesulfonyl chloride?
The IUPAC name of 4-formylbenzenesulfonyl chloride (CID 2759210) is 4-formylbenzenesulfonyl chloride.
What is the SMILES notation for 4-formylbenzenesulfonyl chloride?
The canonical SMILES for 4-formylbenzenesulfonyl chloride is O=Cc1ccc(S(=O)(=O)Cl)cc1.
What is the InChIKey of 4-formylbenzenesulfonyl chloride?
The InChIKey is MSWSPWGBDIQKKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO3S/c8-12(10,11)7-3-1-6(5-9)2-4-7/h1-5H.
What are the key properties of 4-formylbenzenesulfonyl chloride?
4-formylbenzenesulfonyl chloride has a molecular weight of 204.63 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formylbenzenesulfonyl chloride is sourced from PubChem (CID 2759210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).