About imidazo[2,1-b][1,3]thiazole-6-carboxylic acid
imidazo[2,1-b][1,3]thiazole-6-carboxylic acid (PubChem CID 2759354) has the molecular formula C6H4N2O2S
and a molecular weight of 168.18 g/mol. Its IUPAC name is imidazo[2,1-b][1,3]thiazole-6-carboxylic acid.
Molecular Properties
| Compound Name | imidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
| PubChem CID | 2759354 |
| Molecular Formula | C6H4N2O2S |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.00 |
| IUPAC Name | imidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
| SMILES | O=C(O)c1cn2ccsc2n1 |
| InChI | InChI=1S/C6H4N2O2S/c9-5(10)4-3-8-1-2-11-6(8)7-4/h1-3H,(H,9,10) |
| InChIKey | BAKIBSRDBASFAQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imidazo[2,1-b][1,3]thiazole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The IUPAC name of imidazo[2,1-b][1,3]thiazole-6-carboxylic acid (CID 2759354) is imidazo[2,1-b][1,3]thiazole-6-carboxylic acid.
What is the SMILES notation for imidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The canonical SMILES for imidazo[2,1-b][1,3]thiazole-6-carboxylic acid is O=C(O)c1cn2ccsc2n1.
What is the InChIKey of imidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The InChIKey is BAKIBSRDBASFAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2S/c9-5(10)4-3-8-1-2-11-6(8)7-4/h1-3H,(H,9,10).
What are the key properties of imidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
imidazo[2,1-b][1,3]thiazole-6-carboxylic acid has a molecular weight of 168.18 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[2,1-b][1,3]thiazole-6-carboxylic acid is sourced from PubChem (CID 2759354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).