About 5-isothiocyanato-2,3-dihydro-1H-indene
5-isothiocyanato-2,3-dihydro-1H-indene (PubChem CID 2759357) has the molecular formula C10H9NS
and a molecular weight of 175.26 g/mol. Its IUPAC name is 5-isothiocyanato-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 5-isothiocyanato-2,3-dihydro-1H-indene |
| PubChem CID | 2759357 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 5-isothiocyanato-2,3-dihydro-1H-indene |
| SMILES | S=C=Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H9NS/c12-7-11-10-5-4-8-2-1-3-9(8)6-10/h4-6H,1-3H2 |
| InChIKey | DRZNKOAIZHUADV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-isothiocyanato-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isothiocyanato-2,3-dihydro-1H-indene?
The IUPAC name of 5-isothiocyanato-2,3-dihydro-1H-indene (CID 2759357) is 5-isothiocyanato-2,3-dihydro-1H-indene.
What is the SMILES notation for 5-isothiocyanato-2,3-dihydro-1H-indene?
The canonical SMILES for 5-isothiocyanato-2,3-dihydro-1H-indene is S=C=Nc1ccc2c(c1)CCC2.
What is the InChIKey of 5-isothiocyanato-2,3-dihydro-1H-indene?
The InChIKey is DRZNKOAIZHUADV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NS/c12-7-11-10-5-4-8-2-1-3-9(8)6-10/h4-6H,1-3H2.
What are the key properties of 5-isothiocyanato-2,3-dihydro-1H-indene?
5-isothiocyanato-2,3-dihydro-1H-indene has a molecular weight of 175.26 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isothiocyanato-2,3-dihydro-1H-indene is sourced from PubChem (CID 2759357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).