C6H4F9I — CID 2759377
1,1,1-trifluoro-4-iodo-2,2-bis(trifluoromethyl)butane (PubChem CID 2759377) has the molecular formula C6H4F9I and a molecular weight of 373.98 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-iodo-2,2-bis(trifluoromethyl)butane.
| Compound Name | 1,1,1-trifluoro-4-iodo-2,2-bis(trifluoromethyl)butane |
|---|---|
| PubChem CID | 2759377 |
| Molecular Formula | C6H4F9I |
| Molecular Weight | 373.98 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | 1,1,1-trifluoro-4-iodo-2,2-bis(trifluoromethyl)butane |
| SMILES | FC(F)(F)C(CCI)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H4F9I/c7-4(8,9)3(1-2-16,5(10,11)12)6(13,14)15/h1-2H2 |
| InChIKey | GKBGDCARGTVCJU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|