About methyl 2-isocyanatopropanoate
methyl 2-isocyanatopropanoate (PubChem CID 2759403) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is methyl 2-isocyanatopropanoate.
Molecular Properties
| Compound Name | methyl 2-isocyanatopropanoate |
| PubChem CID | 2759403 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | methyl 2-isocyanatopropanoate |
| SMILES | COC(=O)C(C)N=C=O |
| InChI | InChI=1S/C5H7NO3/c1-4(6-3-7)5(8)9-2/h4H,1-2H3 |
| InChIKey | ZYILYULSVKLHKZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-isocyanatopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-isocyanatopropanoate?
The IUPAC name of methyl 2-isocyanatopropanoate (CID 2759403) is methyl 2-isocyanatopropanoate.
What is the SMILES notation for methyl 2-isocyanatopropanoate?
The canonical SMILES for methyl 2-isocyanatopropanoate is COC(=O)C(C)N=C=O.
What is the InChIKey of methyl 2-isocyanatopropanoate?
The InChIKey is ZYILYULSVKLHKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3/c1-4(6-3-7)5(8)9-2/h4H,1-2H3.
What are the key properties of methyl 2-isocyanatopropanoate?
methyl 2-isocyanatopropanoate has a molecular weight of 129.11 g/mol, XLogP of -0.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-isocyanatopropanoate is sourced from PubChem (CID 2759403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).