About methyl 2-isocyano-2,4-dimethylpentanoate
methyl 2-isocyano-2,4-dimethylpentanoate (PubChem CID 2759425) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is methyl 2-isocyano-2,4-dimethylpentanoate.
Molecular Properties
| Compound Name | methyl 2-isocyano-2,4-dimethylpentanoate |
| PubChem CID | 2759425 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | methyl 2-isocyano-2,4-dimethylpentanoate |
| SMILES | [C-]#[N+]C(C)(CC(C)C)C(=O)OC |
| InChI | InChI=1S/C9H15NO2/c1-7(2)6-9(3,10-4)8(11)12-5/h7H,6H2,1-3,5H3 |
| InChIKey | WBBLGBLTTADXTD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-isocyano-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-isocyano-2,4-dimethylpentanoate?
The IUPAC name of methyl 2-isocyano-2,4-dimethylpentanoate (CID 2759425) is methyl 2-isocyano-2,4-dimethylpentanoate.
What is the SMILES notation for methyl 2-isocyano-2,4-dimethylpentanoate?
The canonical SMILES for methyl 2-isocyano-2,4-dimethylpentanoate is [C-]#[N+]C(C)(CC(C)C)C(=O)OC.
What is the InChIKey of methyl 2-isocyano-2,4-dimethylpentanoate?
The InChIKey is WBBLGBLTTADXTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-7(2)6-9(3,10-4)8(11)12-5/h7H,6H2,1-3,5H3.
What are the key properties of methyl 2-isocyano-2,4-dimethylpentanoate?
methyl 2-isocyano-2,4-dimethylpentanoate has a molecular weight of 169.22 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-isocyano-2,4-dimethylpentanoate is sourced from PubChem (CID 2759425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).