About 4-propan-2-ylbenzoyl chloride
4-propan-2-ylbenzoyl chloride (PubChem CID 2759486) has the molecular formula C10H11ClO
and a molecular weight of 182.65 g/mol. Its IUPAC name is 4-propan-2-ylbenzoyl chloride.
Molecular Properties
| Compound Name | 4-propan-2-ylbenzoyl chloride |
| PubChem CID | 2759486 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 4-propan-2-ylbenzoyl chloride |
| SMILES | CC(C)c1ccc(C(=O)Cl)cc1 |
| InChI | InChI=1S/C10H11ClO/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3 |
| InChIKey | LBSYWDTVBUZMCM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-ylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylbenzoyl chloride?
The IUPAC name of 4-propan-2-ylbenzoyl chloride (CID 2759486) is 4-propan-2-ylbenzoyl chloride.
What is the SMILES notation for 4-propan-2-ylbenzoyl chloride?
The canonical SMILES for 4-propan-2-ylbenzoyl chloride is CC(C)c1ccc(C(=O)Cl)cc1.
What is the InChIKey of 4-propan-2-ylbenzoyl chloride?
The InChIKey is LBSYWDTVBUZMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3.
What are the key properties of 4-propan-2-ylbenzoyl chloride?
4-propan-2-ylbenzoyl chloride has a molecular weight of 182.65 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylbenzoyl chloride is sourced from PubChem (CID 2759486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).