C14H16N2 — CID 2759812
1-(2-methylphenyl)-N-(pyridin-2-ylmethyl)methanamine (PubChem CID 2759812) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 1-(2-methylphenyl)-N-(pyridin-2-ylmethyl)methanamine.
| Compound Name | 1-(2-methylphenyl)-N-(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 2759812 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-(2-methylphenyl)-N-(pyridin-2-ylmethyl)methanamine |
| SMILES | Cc1ccccc1CNCc1ccccn1 |
| InChI | InChI=1S/C14H16N2/c1-12-6-2-3-7-13(12)10-15-11-14-8-4-5-9-16-14/h2-9,15H,10-11H2,1H3 |
| InChIKey | QFQTUZCRVMUDAM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |