About 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde
2-methylimidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 2759859) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde |
| PubChem CID | 2759859 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | Cc1nc2ccccn2c1C=O |
| InChI | InChI=1S/C9H8N2O/c1-7-8(6-12)11-5-3-2-4-9(11)10-7/h2-6H,1H3 |
| InChIKey | MCSIFRRJDAQKML-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde?
The IUPAC name of 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde (CID 2759859) is 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde.
What is the SMILES notation for 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde?
The canonical SMILES for 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde is Cc1nc2ccccn2c1C=O.
What is the InChIKey of 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde?
The InChIKey is MCSIFRRJDAQKML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c1-7-8(6-12)11-5-3-2-4-9(11)10-7/h2-6H,1H3.
What are the key properties of 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde?
2-methylimidazo[1,2-a]pyridine-3-carbaldehyde has a molecular weight of 160.18 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazo[1,2-a]pyridine-3-carbaldehyde is sourced from PubChem (CID 2759859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).