About 1-nonan-5-ylpiperazine
1-nonan-5-ylpiperazine (PubChem CID 2760244) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-nonan-5-ylpiperazine.
Molecular Properties
| Compound Name | 1-nonan-5-ylpiperazine |
| PubChem CID | 2760244 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 1-nonan-5-ylpiperazine |
| SMILES | CCCCC(CCCC)N1CCNCC1 |
| InChI | InChI=1S/C13H28N2/c1-3-5-7-13(8-6-4-2)15-11-9-14-10-12-15/h13-14H,3-12H2,1-2H3 |
| InChIKey | CZWMOMPWEKTUJW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-nonan-5-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonan-5-ylpiperazine?
The IUPAC name of 1-nonan-5-ylpiperazine (CID 2760244) is 1-nonan-5-ylpiperazine.
What is the SMILES notation for 1-nonan-5-ylpiperazine?
The canonical SMILES for 1-nonan-5-ylpiperazine is CCCCC(CCCC)N1CCNCC1.
What is the InChIKey of 1-nonan-5-ylpiperazine?
The InChIKey is CZWMOMPWEKTUJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2/c1-3-5-7-13(8-6-4-2)15-11-9-14-10-12-15/h13-14H,3-12H2,1-2H3.
What are the key properties of 1-nonan-5-ylpiperazine?
1-nonan-5-ylpiperazine has a molecular weight of 212.38 g/mol, XLogP of 2.64, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonan-5-ylpiperazine is sourced from PubChem (CID 2760244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).