About 1-amino-3-octylthiourea
1-amino-3-octylthiourea (PubChem CID 2760251) has the molecular formula C9H21N3S
and a molecular weight of 203.35 g/mol. Its IUPAC name is 1-amino-3-octylthiourea.
Molecular Properties
| Compound Name | 1-amino-3-octylthiourea |
| PubChem CID | 2760251 |
| Molecular Formula | C9H21N3S |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 1-amino-3-octylthiourea |
| SMILES | CCCCCCCCNC(=S)NN |
| InChI | InChI=1S/C9H21N3S/c1-2-3-4-5-6-7-8-11-9(13)12-10/h2-8,10H2,1H3,(H2,11,12,13) |
| InChIKey | HIVORGQURSSTBG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-octylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-octylthiourea?
The IUPAC name of 1-amino-3-octylthiourea (CID 2760251) is 1-amino-3-octylthiourea.
What is the SMILES notation for 1-amino-3-octylthiourea?
The canonical SMILES for 1-amino-3-octylthiourea is CCCCCCCCNC(=S)NN.
What is the InChIKey of 1-amino-3-octylthiourea?
The InChIKey is HIVORGQURSSTBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3S/c1-2-3-4-5-6-7-8-11-9(13)12-10/h2-8,10H2,1H3,(H2,11,12,13).
What are the key properties of 1-amino-3-octylthiourea?
1-amino-3-octylthiourea has a molecular weight of 203.35 g/mol, XLogP of 1.68, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-octylthiourea is sourced from PubChem (CID 2760251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).