C10H5F10IO3S — CID 2760327
1,1,2,2,3,3,3-heptafluoropropyl(phenyl)iodanium;trifluoromethanesulfonate (PubChem CID 2760327) has the molecular formula C10H5F10IO3S and a molecular weight of 522.10 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropyl(phenyl)iodanium;trifluoromethanesulfonate.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropyl(phenyl)iodanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 2760327 |
| Molecular Formula | C10H5F10IO3S |
| Molecular Weight | 522.10 g/mol |
| Exact Mass | 521.88 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropyl(phenyl)iodanium;trifluoromethanesulfonate |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)[I+]c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H5F7I.CHF3O3S/c10-7(11,8(12,13)14)9(15,16)17-6-4-2-1-3-5-6;2-1(3,4)8(5,6)7/h1-5H;(H,5,6,7)/q+1;/p-1 |
| InChIKey | YBVOPUOUKFHORP-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.10 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|