About 4-phenoxybenzenethiol
4-phenoxybenzenethiol (PubChem CID 2760354) has the molecular formula C12H10OS
and a molecular weight of 202.28 g/mol. Its IUPAC name is 4-phenoxybenzenethiol.
Molecular Properties
| Compound Name | 4-phenoxybenzenethiol |
| PubChem CID | 2760354 |
| Molecular Formula | C12H10OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 4-phenoxybenzenethiol |
| SMILES | Sc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10OS/c14-12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h1-9,14H |
| InChIKey | VUFOTXYLUWEYFC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-phenoxybenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenoxybenzenethiol?
The IUPAC name of 4-phenoxybenzenethiol (CID 2760354) is 4-phenoxybenzenethiol.
What is the SMILES notation for 4-phenoxybenzenethiol?
The canonical SMILES for 4-phenoxybenzenethiol is Sc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 4-phenoxybenzenethiol?
The InChIKey is VUFOTXYLUWEYFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10OS/c14-12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h1-9,14H.
What are the key properties of 4-phenoxybenzenethiol?
4-phenoxybenzenethiol has a molecular weight of 202.28 g/mol, XLogP of 3.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenoxybenzenethiol is sourced from PubChem (CID 2760354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).