About 2-anilinopropanoic acid
2-anilinopropanoic acid (PubChem CID 2760357) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-anilinopropanoic acid.
Molecular Properties
| Compound Name | 2-anilinopropanoic acid |
| PubChem CID | 2760357 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-anilinopropanoic acid |
| SMILES | CC(Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8/h2-7,10H,1H3,(H,11,12) |
| InChIKey | XWKAVQKJQBISOL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-anilinopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinopropanoic acid?
The IUPAC name of 2-anilinopropanoic acid (CID 2760357) is 2-anilinopropanoic acid.
What is the SMILES notation for 2-anilinopropanoic acid?
The canonical SMILES for 2-anilinopropanoic acid is CC(Nc1ccccc1)C(=O)O.
What is the InChIKey of 2-anilinopropanoic acid?
The InChIKey is XWKAVQKJQBISOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8/h2-7,10H,1H3,(H,11,12).
What are the key properties of 2-anilinopropanoic acid?
2-anilinopropanoic acid has a molecular weight of 165.19 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinopropanoic acid is sourced from PubChem (CID 2760357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).