2-anilinopropanoic acid

C9H11NO2 — CID 2760357

IUPAC2-anilinopropanoic acid
SMILESCC(Nc1ccccc1)C(=O)O
InChIInChI=1S/C9H11NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8/h2-7,10H,1H3,(H,11,12)
InChIKeyXWKAVQKJQBISOL-UHFFFAOYSA-N
MW165.19 g/mol
LogP1.57
Rot. Bonds3

About 2-anilinopropanoic acid

2-anilinopropanoic acid (PubChem CID 2760357) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-anilinopropanoic acid.

Molecular Properties

Compound Name2-anilinopropanoic acid
PubChem CID2760357
Molecular FormulaC9H11NO2
Molecular Weight165.19 g/mol
Exact Mass165.08
IUPAC Name2-anilinopropanoic acid
SMILESCC(Nc1ccccc1)C(=O)O
InChIInChI=1S/C9H11NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8/h2-7,10H,1H3,(H,11,12)
InChIKeyXWKAVQKJQBISOL-UHFFFAOYSA-N
XLogP1.57
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.19
LogP ≤ 51.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-anilinopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-anilinopropanoic acid?
The IUPAC name of 2-anilinopropanoic acid (CID 2760357) is 2-anilinopropanoic acid.
What is the SMILES notation for 2-anilinopropanoic acid?
The canonical SMILES for 2-anilinopropanoic acid is CC(Nc1ccccc1)C(=O)O.
What is the InChIKey of 2-anilinopropanoic acid?
The InChIKey is XWKAVQKJQBISOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8/h2-7,10H,1H3,(H,11,12).
What are the key properties of 2-anilinopropanoic acid?
2-anilinopropanoic acid has a molecular weight of 165.19 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinopropanoic acid is sourced from PubChem (CID 2760357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).