About 2-phenylbenzohydrazide
2-phenylbenzohydrazide (PubChem CID 2760365) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-phenylbenzohydrazide.
Molecular Properties
| Compound Name | 2-phenylbenzohydrazide |
| PubChem CID | 2760365 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-phenylbenzohydrazide |
| SMILES | NNC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C13H12N2O/c14-15-13(16)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,14H2,(H,15,16) |
| InChIKey | URSYVWKUCWNLMA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylbenzohydrazide?
The IUPAC name of 2-phenylbenzohydrazide (CID 2760365) is 2-phenylbenzohydrazide.
What is the SMILES notation for 2-phenylbenzohydrazide?
The canonical SMILES for 2-phenylbenzohydrazide is NNC(=O)c1ccccc1-c1ccccc1.
What is the InChIKey of 2-phenylbenzohydrazide?
The InChIKey is URSYVWKUCWNLMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c14-15-13(16)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,14H2,(H,15,16).
What are the key properties of 2-phenylbenzohydrazide?
2-phenylbenzohydrazide has a molecular weight of 212.25 g/mol, XLogP of 1.96, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylbenzohydrazide is sourced from PubChem (CID 2760365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).