About 3-phenylpropylthiourea
3-phenylpropylthiourea (PubChem CID 2760407) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 3-phenylpropylthiourea.
Molecular Properties
| Compound Name | 3-phenylpropylthiourea |
| PubChem CID | 2760407 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-phenylpropylthiourea |
| SMILES | NC(=S)NCCCc1ccccc1 |
| InChI | InChI=1S/C10H14N2S/c11-10(13)12-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H3,11,12,13) |
| InChIKey | AGWZOAHAJCELJQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropylthiourea?
The IUPAC name of 3-phenylpropylthiourea (CID 2760407) is 3-phenylpropylthiourea.
What is the SMILES notation for 3-phenylpropylthiourea?
The canonical SMILES for 3-phenylpropylthiourea is NC(=S)NCCCc1ccccc1.
What is the InChIKey of 3-phenylpropylthiourea?
The InChIKey is AGWZOAHAJCELJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S/c11-10(13)12-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H3,11,12,13).
What are the key properties of 3-phenylpropylthiourea?
3-phenylpropylthiourea has a molecular weight of 194.30 g/mol, XLogP of 1.45, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropylthiourea is sourced from PubChem (CID 2760407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).