About 4-phenylbenzenethiol
4-phenylbenzenethiol (PubChem CID 2760414) has the molecular formula C12H10S
and a molecular weight of 186.28 g/mol. Its IUPAC name is 4-phenylbenzenethiol.
Molecular Properties
| Compound Name | 4-phenylbenzenethiol |
| PubChem CID | 2760414 |
| Molecular Formula | C12H10S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 4-phenylbenzenethiol |
| SMILES | Sc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13H |
| InChIKey | KRVHFFQFZQSNLB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbenzenethiol?
The IUPAC name of 4-phenylbenzenethiol (CID 2760414) is 4-phenylbenzenethiol.
What is the SMILES notation for 4-phenylbenzenethiol?
The canonical SMILES for 4-phenylbenzenethiol is Sc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 4-phenylbenzenethiol?
The InChIKey is KRVHFFQFZQSNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,13H.
What are the key properties of 4-phenylbenzenethiol?
4-phenylbenzenethiol has a molecular weight of 186.28 g/mol, XLogP of 3.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbenzenethiol is sourced from PubChem (CID 2760414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).