C10H12N4S — CID 2760428
4-piperazin-1-ylthieno[3,2-d]pyrimidine (PubChem CID 2760428) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 4-piperazin-1-ylthieno[3,2-d]pyrimidine.
| Compound Name | 4-piperazin-1-ylthieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 2760428 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 4-piperazin-1-ylthieno[3,2-d]pyrimidine |
| SMILES | c1nc(N2CCNCC2)c2sccc2n1 |
| InChI | InChI=1S/C10H12N4S/c1-6-15-9-8(1)12-7-13-10(9)14-4-2-11-3-5-14/h1,6-7,11H,2-5H2 |
| InChIKey | GVNSLBIXJYZCCB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |