About 2-piperazin-1-ylbenzoic acid
2-piperazin-1-ylbenzoic acid (PubChem CID 2760432) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-piperazin-1-ylbenzoic acid.
Molecular Properties
| Compound Name | 2-piperazin-1-ylbenzoic acid |
| PubChem CID | 2760432 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-piperazin-1-ylbenzoic acid |
| SMILES | O=C(O)c1ccccc1N1CCNCC1 |
| InChI | InChI=1S/C11H14N2O2/c14-11(15)9-3-1-2-4-10(9)13-7-5-12-6-8-13/h1-4,12H,5-8H2,(H,14,15) |
| InChIKey | ZYLZQIMSYNAILC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperazin-1-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-ylbenzoic acid?
The IUPAC name of 2-piperazin-1-ylbenzoic acid (CID 2760432) is 2-piperazin-1-ylbenzoic acid.
What is the SMILES notation for 2-piperazin-1-ylbenzoic acid?
The canonical SMILES for 2-piperazin-1-ylbenzoic acid is O=C(O)c1ccccc1N1CCNCC1.
What is the InChIKey of 2-piperazin-1-ylbenzoic acid?
The InChIKey is ZYLZQIMSYNAILC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c14-11(15)9-3-1-2-4-10(9)13-7-5-12-6-8-13/h1-4,12H,5-8H2,(H,14,15).
What are the key properties of 2-piperazin-1-ylbenzoic acid?
2-piperazin-1-ylbenzoic acid has a molecular weight of 206.25 g/mol, XLogP of 0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-ylbenzoic acid is sourced from PubChem (CID 2760432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).