About 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide
2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 2760444) has the molecular formula C9H14N4OS
and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 2760444 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN1CCNCC1)Nc1nccs1 |
| InChI | InChI=1S/C9H14N4OS/c14-8(12-9-11-3-6-15-9)7-13-4-1-10-2-5-13/h3,6,10H,1-2,4-5,7H2,(H,11,12,14) |
| InChIKey | YWWRBWVAUWLRIZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide (CID 2760444) is 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide is O=C(CN1CCNCC1)Nc1nccs1.
What is the InChIKey of 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide?
The InChIKey is YWWRBWVAUWLRIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4OS/c14-8(12-9-11-3-6-15-9)7-13-4-1-10-2-5-13/h3,6,10H,1-2,4-5,7H2,(H,11,12,14).
What are the key properties of 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide?
2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide has a molecular weight of 226.30 g/mol, XLogP of -0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-N-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 2760444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).