C8H16N2O2 — CID 2760459
N-(2-hydroxyethyl)piperidine-3-carboxamide (PubChem CID 2760459) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is N-(2-hydroxyethyl)piperidine-3-carboxamide.
| Compound Name | N-(2-hydroxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 2760459 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | N-(2-hydroxyethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCO)C1CCCNC1 |
| InChI | InChI=1S/C8H16N2O2/c11-5-4-10-8(12)7-2-1-3-9-6-7/h7,9,11H,1-6H2,(H,10,12) |
| InChIKey | RFPHDGCQINZWOO-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |