About ethyl 2-piperidin-3-ylacetate
ethyl 2-piperidin-3-ylacetate (PubChem CID 2760464) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is ethyl 2-piperidin-3-ylacetate.
Molecular Properties
| Compound Name | ethyl 2-piperidin-3-ylacetate |
| PubChem CID | 2760464 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | ethyl 2-piperidin-3-ylacetate |
| SMILES | CCOC(=O)CC1CCCNC1 |
| InChI | InChI=1S/C9H17NO2/c1-2-12-9(11)6-8-4-3-5-10-7-8/h8,10H,2-7H2,1H3 |
| InChIKey | RJFIWCWTENIBKC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-piperidin-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-piperidin-3-ylacetate?
The IUPAC name of ethyl 2-piperidin-3-ylacetate (CID 2760464) is ethyl 2-piperidin-3-ylacetate.
What is the SMILES notation for ethyl 2-piperidin-3-ylacetate?
The canonical SMILES for ethyl 2-piperidin-3-ylacetate is CCOC(=O)CC1CCCNC1.
What is the InChIKey of ethyl 2-piperidin-3-ylacetate?
The InChIKey is RJFIWCWTENIBKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-2-12-9(11)6-8-4-3-5-10-7-8/h8,10H,2-7H2,1H3.
What are the key properties of ethyl 2-piperidin-3-ylacetate?
ethyl 2-piperidin-3-ylacetate has a molecular weight of 171.24 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-piperidin-3-ylacetate is sourced from PubChem (CID 2760464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).