About 2-pyridin-3-ylbenzoic acid
2-pyridin-3-ylbenzoic acid (PubChem CID 2760505) has the molecular formula C12H9NO2
and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-pyridin-3-ylbenzoic acid.
Molecular Properties
| Compound Name | 2-pyridin-3-ylbenzoic acid |
| PubChem CID | 2760505 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-pyridin-3-ylbenzoic acid |
| SMILES | O=C(O)c1ccccc1-c1cccnc1 |
| InChI | InChI=1S/C12H9NO2/c14-12(15)11-6-2-1-5-10(11)9-4-3-7-13-8-9/h1-8H,(H,14,15) |
| InChIKey | DRGNPLUCFXKUAL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-3-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-ylbenzoic acid?
The IUPAC name of 2-pyridin-3-ylbenzoic acid (CID 2760505) is 2-pyridin-3-ylbenzoic acid.
What is the SMILES notation for 2-pyridin-3-ylbenzoic acid?
The canonical SMILES for 2-pyridin-3-ylbenzoic acid is O=C(O)c1ccccc1-c1cccnc1.
What is the InChIKey of 2-pyridin-3-ylbenzoic acid?
The InChIKey is DRGNPLUCFXKUAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2/c14-12(15)11-6-2-1-5-10(11)9-4-3-7-13-8-9/h1-8H,(H,14,15).
What are the key properties of 2-pyridin-3-ylbenzoic acid?
2-pyridin-3-ylbenzoic acid has a molecular weight of 199.21 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-ylbenzoic acid is sourced from PubChem (CID 2760505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).