C24H42S2 — CID 27605380
(2S,5R)-2,3-ditert-butyl-5-[(2S,5S)-4,5-ditert-butyl-2,5-dihydrothiophen-2-yl]-2,5-dihydrothiophene (PubChem CID 27605380) has the molecular formula C24H42S2 and a molecular weight of 394.73 g/mol. Its IUPAC name is (2S,5R)-2,3-ditert-butyl-5-[(2S,5S)-4,5-ditert-butyl-2,5-dihydrothiophen-2-yl]-2,5-dihydrothiophene.
| Compound Name | (2S,5R)-2,3-ditert-butyl-5-[(2S,5S)-4,5-ditert-butyl-2,5-dihydrothiophen-2-yl]-2,5-dihydrothiophene |
|---|---|
| PubChem CID | 27605380 |
| Molecular Formula | C24H42S2 |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (2S,5R)-2,3-ditert-butyl-5-[(2S,5S)-4,5-ditert-butyl-2,5-dihydrothiophen-2-yl]-2,5-dihydrothiophene |
| SMILES | CC(C)(C)C1=C[C@@H]([C@H]2C=C(C(C)(C)C)[C@H](C(C)(C)C)S2)S[C@H]1C(C)(C)C |
| InChI | InChI=1S/C24H42S2/c1-21(2,3)15-13-17(25-19(15)23(7,8)9)18-14-16(22(4,5)6)20(26-18)24(10,11)12/h13-14,17-20H,1-12H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | JMJFTYVEDVZNOF-IYWMVGAKSA-N |
| XLogP | 7.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|