About 3-pyrrol-1-ylaniline
3-pyrrol-1-ylaniline (PubChem CID 2760546) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-pyrrol-1-ylaniline.
Molecular Properties
| Compound Name | 3-pyrrol-1-ylaniline |
| PubChem CID | 2760546 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 3-pyrrol-1-ylaniline |
| SMILES | Nc1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C10H10N2/c11-9-4-3-5-10(8-9)12-6-1-2-7-12/h1-8H,11H2 |
| InChIKey | PJGDCPOPSNUYHC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrrol-1-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrol-1-ylaniline?
The IUPAC name of 3-pyrrol-1-ylaniline (CID 2760546) is 3-pyrrol-1-ylaniline.
What is the SMILES notation for 3-pyrrol-1-ylaniline?
The canonical SMILES for 3-pyrrol-1-ylaniline is Nc1cccc(-n2cccc2)c1.
What is the InChIKey of 3-pyrrol-1-ylaniline?
The InChIKey is PJGDCPOPSNUYHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c11-9-4-3-5-10(8-9)12-6-1-2-7-12/h1-8H,11H2.
What are the key properties of 3-pyrrol-1-ylaniline?
3-pyrrol-1-ylaniline has a molecular weight of 158.20 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrol-1-ylaniline is sourced from PubChem (CID 2760546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).