About quinoline-2-carbonyl chloride
quinoline-2-carbonyl chloride (PubChem CID 2760547) has the molecular formula C10H6ClNO
and a molecular weight of 191.62 g/mol. Its IUPAC name is quinoline-2-carbonyl chloride.
Molecular Properties
| Compound Name | quinoline-2-carbonyl chloride |
| PubChem CID | 2760547 |
| Molecular Formula | C10H6ClNO |
| Molecular Weight | 191.62 g/mol |
| Exact Mass | 191.01 |
| IUPAC Name | quinoline-2-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H6ClNO/c11-10(13)9-6-5-7-3-1-2-4-8(7)12-9/h1-6H |
| InChIKey | WFVMVMAUXYOQSW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze quinoline-2-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-2-carbonyl chloride?
The IUPAC name of quinoline-2-carbonyl chloride (CID 2760547) is quinoline-2-carbonyl chloride.
What is the SMILES notation for quinoline-2-carbonyl chloride?
The canonical SMILES for quinoline-2-carbonyl chloride is O=C(Cl)c1ccc2ccccc2n1.
What is the InChIKey of quinoline-2-carbonyl chloride?
The InChIKey is WFVMVMAUXYOQSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClNO/c11-10(13)9-6-5-7-3-1-2-4-8(7)12-9/h1-6H.
What are the key properties of quinoline-2-carbonyl chloride?
quinoline-2-carbonyl chloride has a molecular weight of 191.62 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-2-carbonyl chloride is sourced from PubChem (CID 2760547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).