2-(4-methylphenyl)acetyl chloride

C9H9ClO — CID 2760634

IUPAC2-(4-methylphenyl)acetyl chloride
SMILESCc1ccc(CC(=O)Cl)cc1
InChIInChI=1S/C9H9ClO/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3
InChIKeyQDZAWVLWIMOXJT-UHFFFAOYSA-N
MW168.62 g/mol
LogP2.30
Rot. Bonds2

About 2-(4-methylphenyl)acetyl chloride

2-(4-methylphenyl)acetyl chloride (PubChem CID 2760634) has the molecular formula C9H9ClO and a molecular weight of 168.62 g/mol. Its IUPAC name is 2-(4-methylphenyl)acetyl chloride.

Molecular Properties

Compound Name2-(4-methylphenyl)acetyl chloride
PubChem CID2760634
Molecular FormulaC9H9ClO
Molecular Weight168.62 g/mol
Exact Mass168.03
IUPAC Name2-(4-methylphenyl)acetyl chloride
SMILESCc1ccc(CC(=O)Cl)cc1
InChIInChI=1S/C9H9ClO/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3
InChIKeyQDZAWVLWIMOXJT-UHFFFAOYSA-N
XLogP2.30
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.62
LogP ≤ 52.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(4-methylphenyl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-methylphenyl)acetyl chloride?
The IUPAC name of 2-(4-methylphenyl)acetyl chloride (CID 2760634) is 2-(4-methylphenyl)acetyl chloride.
What is the SMILES notation for 2-(4-methylphenyl)acetyl chloride?
The canonical SMILES for 2-(4-methylphenyl)acetyl chloride is Cc1ccc(CC(=O)Cl)cc1.
What is the InChIKey of 2-(4-methylphenyl)acetyl chloride?
The InChIKey is QDZAWVLWIMOXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3.
What are the key properties of 2-(4-methylphenyl)acetyl chloride?
2-(4-methylphenyl)acetyl chloride has a molecular weight of 168.62 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)acetyl chloride is sourced from PubChem (CID 2760634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).