About 2-(4-methylphenyl)acetyl chloride
2-(4-methylphenyl)acetyl chloride (PubChem CID 2760634) has the molecular formula C9H9ClO
and a molecular weight of 168.62 g/mol. Its IUPAC name is 2-(4-methylphenyl)acetyl chloride.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)acetyl chloride |
| PubChem CID | 2760634 |
| Molecular Formula | C9H9ClO |
| Molecular Weight | 168.62 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 2-(4-methylphenyl)acetyl chloride |
| SMILES | Cc1ccc(CC(=O)Cl)cc1 |
| InChI | InChI=1S/C9H9ClO/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3 |
| InChIKey | QDZAWVLWIMOXJT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.62 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenyl)acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)acetyl chloride?
The IUPAC name of 2-(4-methylphenyl)acetyl chloride (CID 2760634) is 2-(4-methylphenyl)acetyl chloride.
What is the SMILES notation for 2-(4-methylphenyl)acetyl chloride?
The canonical SMILES for 2-(4-methylphenyl)acetyl chloride is Cc1ccc(CC(=O)Cl)cc1.
What is the InChIKey of 2-(4-methylphenyl)acetyl chloride?
The InChIKey is QDZAWVLWIMOXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3.
What are the key properties of 2-(4-methylphenyl)acetyl chloride?
2-(4-methylphenyl)acetyl chloride has a molecular weight of 168.62 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)acetyl chloride is sourced from PubChem (CID 2760634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).