About 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione
4-(4-methylphenyl)-1,2,4-triazole-3,5-dione (PubChem CID 2760671) has the molecular formula C9H7N3O2
and a molecular weight of 189.17 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione |
| PubChem CID | 2760671 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione |
| SMILES | Cc1ccc(N2C(=O)N=NC2=O)cc1 |
| InChI | InChI=1S/C9H7N3O2/c1-6-2-4-7(5-3-6)12-8(13)10-11-9(12)14/h2-5H,1H3 |
| InChIKey | ZQMWFABJLXYBSW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione?
The IUPAC name of 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione (CID 2760671) is 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione.
What is the SMILES notation for 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione?
The canonical SMILES for 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione is Cc1ccc(N2C(=O)N=NC2=O)cc1.
What is the InChIKey of 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione?
The InChIKey is ZQMWFABJLXYBSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2/c1-6-2-4-7(5-3-6)12-8(13)10-11-9(12)14/h2-5H,1H3.
What are the key properties of 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione?
4-(4-methylphenyl)-1,2,4-triazole-3,5-dione has a molecular weight of 189.17 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)-1,2,4-triazole-3,5-dione is sourced from PubChem (CID 2760671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).