About N-benzyl-1,1,1-trifluoropropan-2-imine
N-benzyl-1,1,1-trifluoropropan-2-imine (PubChem CID 2760746) has the molecular formula C10H10F3N
and a molecular weight of 201.19 g/mol. Its IUPAC name is N-benzyl-1,1,1-trifluoropropan-2-imine.
Molecular Properties
| Compound Name | N-benzyl-1,1,1-trifluoropropan-2-imine |
| PubChem CID | 2760746 |
| Molecular Formula | C10H10F3N |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | N-benzyl-1,1,1-trifluoropropan-2-imine |
| SMILES | C/C(=N\Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H10F3N/c1-8(10(11,12)13)14-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3/b14-8+ |
| InChIKey | MYVITOFBNPFGNU-RIYZIHGNSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-1,1,1-trifluoropropan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1,1,1-trifluoropropan-2-imine?
The IUPAC name of N-benzyl-1,1,1-trifluoropropan-2-imine (CID 2760746) is N-benzyl-1,1,1-trifluoropropan-2-imine.
What is the SMILES notation for N-benzyl-1,1,1-trifluoropropan-2-imine?
The canonical SMILES for N-benzyl-1,1,1-trifluoropropan-2-imine is C/C(=N\Cc1ccccc1)C(F)(F)F.
What is the InChIKey of N-benzyl-1,1,1-trifluoropropan-2-imine?
The InChIKey is MYVITOFBNPFGNU-RIYZIHGNSA-N. The full InChI is InChI=1S/C10H10F3N/c1-8(10(11,12)13)14-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3/b14-8+.
What are the key properties of N-benzyl-1,1,1-trifluoropropan-2-imine?
N-benzyl-1,1,1-trifluoropropan-2-imine has a molecular weight of 201.19 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1,1,1-trifluoropropan-2-imine is sourced from PubChem (CID 2760746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).