About trimethylsilylmethyl 2-methylprop-2-enoate
trimethylsilylmethyl 2-methylprop-2-enoate (PubChem CID 2760855) has the molecular formula C8H16O2Si
and a molecular weight of 172.30 g/mol. Its IUPAC name is trimethylsilylmethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | trimethylsilylmethyl 2-methylprop-2-enoate |
| PubChem CID | 2760855 |
| Molecular Formula | C8H16O2Si |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | trimethylsilylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC[Si](C)(C)C |
| InChI | InChI=1S/C8H16O2Si/c1-7(2)8(9)10-6-11(3,4)5/h1,6H2,2-5H3 |
| InChIKey | VGOXVARSERTCRY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilylmethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilylmethyl 2-methylprop-2-enoate?
The IUPAC name of trimethylsilylmethyl 2-methylprop-2-enoate (CID 2760855) is trimethylsilylmethyl 2-methylprop-2-enoate.
What is the SMILES notation for trimethylsilylmethyl 2-methylprop-2-enoate?
The canonical SMILES for trimethylsilylmethyl 2-methylprop-2-enoate is C=C(C)C(=O)OC[Si](C)(C)C.
What is the InChIKey of trimethylsilylmethyl 2-methylprop-2-enoate?
The InChIKey is VGOXVARSERTCRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2Si/c1-7(2)8(9)10-6-11(3,4)5/h1,6H2,2-5H3.
What are the key properties of trimethylsilylmethyl 2-methylprop-2-enoate?
trimethylsilylmethyl 2-methylprop-2-enoate has a molecular weight of 172.30 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilylmethyl 2-methylprop-2-enoate is sourced from PubChem (CID 2760855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).