About 2-(aminomethyl)-N,N-dimethylaniline
2-(aminomethyl)-N,N-dimethylaniline (PubChem CID 2760939) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 2-(aminomethyl)-N,N-dimethylaniline |
| PubChem CID | 2760939 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-(aminomethyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1CN |
| InChI | InChI=1S/C9H14N2/c1-11(2)9-6-4-3-5-8(9)7-10/h3-6H,7,10H2,1-2H3 |
| InChIKey | MMSHDAHNUHLXQD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(aminomethyl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-N,N-dimethylaniline?
The IUPAC name of 2-(aminomethyl)-N,N-dimethylaniline (CID 2760939) is 2-(aminomethyl)-N,N-dimethylaniline.
What is the SMILES notation for 2-(aminomethyl)-N,N-dimethylaniline?
The canonical SMILES for 2-(aminomethyl)-N,N-dimethylaniline is CN(C)c1ccccc1CN.
What is the InChIKey of 2-(aminomethyl)-N,N-dimethylaniline?
The InChIKey is MMSHDAHNUHLXQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-11(2)9-6-4-3-5-8(9)7-10/h3-6H,7,10H2,1-2H3.
What are the key properties of 2-(aminomethyl)-N,N-dimethylaniline?
2-(aminomethyl)-N,N-dimethylaniline has a molecular weight of 150.22 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-N,N-dimethylaniline is sourced from PubChem (CID 2760939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).