C14H15N3O3 — CID 2761151
3-(1,3-benzodioxol-5-yl)-5-piperidin-4-yl-1,2,4-oxadiazole (PubChem CID 2761151) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-piperidin-4-yl-1,2,4-oxadiazole.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-piperidin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2761151 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-piperidin-4-yl-1,2,4-oxadiazole |
| SMILES | c1cc2c(cc1-c1noc(C3CCNCC3)n1)OCO2 |
| InChI | InChI=1S/C14H15N3O3/c1-2-11-12(19-8-18-11)7-10(1)13-16-14(20-17-13)9-3-5-15-6-4-9/h1-2,7,9,15H,3-6,8H2 |
| InChIKey | WJLRNCOTWSCIOZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |