About 2-butoxyethyl carbamate
2-butoxyethyl carbamate (PubChem CID 27621) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-butoxyethyl carbamate.
Molecular Properties
| Compound Name | 2-butoxyethyl carbamate |
| PubChem CID | 27621 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 2-butoxyethyl carbamate |
| SMILES | CCCCOCCOC(N)=O |
| InChI | InChI=1S/C7H15NO3/c1-2-3-4-10-5-6-11-7(8)9/h2-6H2,1H3,(H2,8,9) |
| InChIKey | QHHQZURUTXQADT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxyethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxyethyl carbamate?
The IUPAC name of 2-butoxyethyl carbamate (CID 27621) is 2-butoxyethyl carbamate.
What is the SMILES notation for 2-butoxyethyl carbamate?
The canonical SMILES for 2-butoxyethyl carbamate is CCCCOCCOC(N)=O.
What is the InChIKey of 2-butoxyethyl carbamate?
The InChIKey is QHHQZURUTXQADT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO3/c1-2-3-4-10-5-6-11-7(8)9/h2-6H2,1H3,(H2,8,9).
What are the key properties of 2-butoxyethyl carbamate?
2-butoxyethyl carbamate has a molecular weight of 161.20 g/mol, XLogP of 0.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethyl carbamate is sourced from PubChem (CID 27621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).