C42H41Cl2N5O3 — CID 2762567
N-(6-chloro-2-methoxyacridin-9-yl)-N'-[3-[(6-chloro-2-methoxyacridin-9-yl)amino]propyl]-N'-[(3-methoxyphenyl)methyl]propane-1,3-diamine (PubChem CID 2762567) has the molecular formula C42H41Cl2N5O3 and a molecular weight of 734.73 g/mol. Its IUPAC name is N-(6-chloro-2-methoxyacridin-9-yl)-N'-[3-[(6-chloro-2-methoxyacridin-9-yl)amino]propyl]-N'-[(3-methoxyphenyl)methyl]propane-1,3-diamine.
| Compound Name | N-(6-chloro-2-methoxyacridin-9-yl)-N'-[3-[(6-chloro-2-methoxyacridin-9-yl)amino]propyl]-N'-[(3-methoxyphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 2762567 |
| Molecular Formula | C42H41Cl2N5O3 |
| Molecular Weight | 734.73 g/mol |
| Exact Mass | 733.26 |
| IUPAC Name | N-(6-chloro-2-methoxyacridin-9-yl)-N'-[3-[(6-chloro-2-methoxyacridin-9-yl)amino]propyl]-N'-[(3-methoxyphenyl)methyl]propane-1,3-diamine |
| SMILES | COc1cccc(CN(CCCNc2c3ccc(Cl)cc3nc3ccc(OC)cc23)CCCNc2c3ccc(Cl)cc3nc3ccc(OC)cc23)c1 |
| InChI | InChI=1S/C42H41Cl2N5O3/c1-50-30-8-4-7-27(21-30)26-49(19-5-17-45-41-33-13-9-28(43)22-39(33)47-37-15-11-31(51-2)24-35(37)41)20-6-18-46-42-34-14-10-29(44)23-40(34)48-38-16-12-32(52-3)25-36(38)42/h4,7-16,21-25H,5-6,17-20,26H2,1-3H3,(H,45,47)(H,46,48) |
| InChIKey | HFDVRDSHSGEDIP-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 80.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.73 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|