C6Br4S2 — CID 2762568
2,3,5,6-tetrabromothieno[3,2-b]thiophene (PubChem CID 2762568) has the molecular formula C6Br4S2 and a molecular weight of 455.82 g/mol. Its IUPAC name is 2,3,5,6-tetrabromothieno[3,2-b]thiophene.
| Compound Name | 2,3,5,6-tetrabromothieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 2762568 |
| Molecular Formula | C6Br4S2 |
| Molecular Weight | 455.82 g/mol |
| Exact Mass | 451.62 |
| IUPAC Name | 2,3,5,6-tetrabromothieno[3,2-b]thiophene |
| SMILES | Brc1sc2c(Br)c(Br)sc2c1Br |
| InChI | InChI=1S/C6Br4S2/c7-1-3-4(12-5(1)9)2(8)6(10)11-3 |
| InChIKey | CWCKRNKYWPNOAZ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.82 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |