C13H28N2O2 — CID 2762632
2-hydroxyethyl-dimethyl-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)azanium (PubChem CID 2762632) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-hydroxyethyl-dimethyl-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)azanium.
| Compound Name | 2-hydroxyethyl-dimethyl-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)azanium |
|---|---|
| PubChem CID | 2762632 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2-hydroxyethyl-dimethyl-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)azanium |
| SMILES | CC1(C)CC([N+](C)(C)CCO)CC(C)(C)N1[O-] |
| InChI | InChI=1S/C13H28N2O2/c1-12(2)9-11(15(5,6)7-8-16)10-13(3,4)14(12)17/h11,16H,7-10H2,1-6H3 |
| InChIKey | VXIAHXVBBZVSHM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|