C15H15N5O4S — CID 2762724
(2S,5R,6R)-6-[(4-azidobenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 2762724) has the molecular formula C15H15N5O4S and a molecular weight of 361.38 g/mol. Its IUPAC name is (2S,5R,6R)-6-[(4-azidobenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-[(4-azidobenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 2762724 |
| Molecular Formula | C15H15N5O4S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (2S,5R,6R)-6-[(4-azidobenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)c3ccc(N=[N+]=[N-])cc3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C15H15N5O4S/c1-15(2)10(14(23)24)20-12(22)9(13(20)25-15)17-11(21)7-3-5-8(6-4-7)18-19-16/h3-6,9-10,13H,1-2H3,(H,17,21)(H,23,24)/t9-,10+,13-/m1/s1 |
| InChIKey | WSPHPHTWMSJUJQ-GBIKHYSHSA-N |
| XLogP | 1.87 |
| TPSA | 135.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|