About 2-phenylpyridin-4-amine
2-phenylpyridin-4-amine (PubChem CID 2762833) has the molecular formula C11H10N2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-phenylpyridin-4-amine.
Molecular Properties
| Compound Name | 2-phenylpyridin-4-amine |
| PubChem CID | 2762833 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-phenylpyridin-4-amine |
| SMILES | Nc1ccnc(-c2ccccc2)c1 |
| InChI | InChI=1S/C11H10N2/c12-10-6-7-13-11(8-10)9-4-2-1-3-5-9/h1-8H,(H2,12,13) |
| InChIKey | CHVKPWIABFICLK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpyridin-4-amine?
The IUPAC name of 2-phenylpyridin-4-amine (CID 2762833) is 2-phenylpyridin-4-amine.
What is the SMILES notation for 2-phenylpyridin-4-amine?
The canonical SMILES for 2-phenylpyridin-4-amine is Nc1ccnc(-c2ccccc2)c1.
What is the InChIKey of 2-phenylpyridin-4-amine?
The InChIKey is CHVKPWIABFICLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c12-10-6-7-13-11(8-10)9-4-2-1-3-5-9/h1-8H,(H2,12,13).
What are the key properties of 2-phenylpyridin-4-amine?
2-phenylpyridin-4-amine has a molecular weight of 170.21 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpyridin-4-amine is sourced from PubChem (CID 2762833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).