About 4-bromo-2-methylpyridine
4-bromo-2-methylpyridine (PubChem CID 2762835) has the molecular formula C6H6BrN
and a molecular weight of 172.03 g/mol. Its IUPAC name is 4-bromo-2-methylpyridine.
Molecular Properties
| Compound Name | 4-bromo-2-methylpyridine |
| PubChem CID | 2762835 |
| Molecular Formula | C6H6BrN |
| Molecular Weight | 172.03 g/mol |
| Exact Mass | 170.97 |
| IUPAC Name | 4-bromo-2-methylpyridine |
| SMILES | Cc1cc(Br)ccn1 |
| InChI | InChI=1S/C6H6BrN/c1-5-4-6(7)2-3-8-5/h2-4H,1H3 |
| InChIKey | JFBMFWHEXBLFCR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.03 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-2-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-methylpyridine?
The IUPAC name of 4-bromo-2-methylpyridine (CID 2762835) is 4-bromo-2-methylpyridine.
What is the SMILES notation for 4-bromo-2-methylpyridine?
The canonical SMILES for 4-bromo-2-methylpyridine is Cc1cc(Br)ccn1.
What is the InChIKey of 4-bromo-2-methylpyridine?
The InChIKey is JFBMFWHEXBLFCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN/c1-5-4-6(7)2-3-8-5/h2-4H,1H3.
What are the key properties of 4-bromo-2-methylpyridine?
4-bromo-2-methylpyridine has a molecular weight of 172.03 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methylpyridine is sourced from PubChem (CID 2762835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).