About pyridine-3,5-disulfonic acid
pyridine-3,5-disulfonic acid (PubChem CID 2762897) has the molecular formula C5H5NO6S2
and a molecular weight of 239.23 g/mol. Its IUPAC name is pyridine-3,5-disulfonic acid.
Molecular Properties
| Compound Name | pyridine-3,5-disulfonic acid |
| PubChem CID | 2762897 |
| Molecular Formula | C5H5NO6S2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 238.96 |
| IUPAC Name | pyridine-3,5-disulfonic acid |
| SMILES | O=S(=O)(O)c1cncc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C5H5NO6S2/c7-13(8,9)4-1-5(3-6-2-4)14(10,11)12/h1-3H,(H,7,8,9)(H,10,11,12) |
| InChIKey | QRYROSZXZPINDI-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze pyridine-3,5-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-3,5-disulfonic acid?
The IUPAC name of pyridine-3,5-disulfonic acid (CID 2762897) is pyridine-3,5-disulfonic acid.
What is the SMILES notation for pyridine-3,5-disulfonic acid?
The canonical SMILES for pyridine-3,5-disulfonic acid is O=S(=O)(O)c1cncc(S(=O)(=O)O)c1.
What is the InChIKey of pyridine-3,5-disulfonic acid?
The InChIKey is QRYROSZXZPINDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO6S2/c7-13(8,9)4-1-5(3-6-2-4)14(10,11)12/h1-3H,(H,7,8,9)(H,10,11,12).
What are the key properties of pyridine-3,5-disulfonic acid?
pyridine-3,5-disulfonic acid has a molecular weight of 239.23 g/mol, XLogP of -0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-3,5-disulfonic acid is sourced from PubChem (CID 2762897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).