C11H19I — CID 2763008
2-(iodomethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 2763008) has the molecular formula C11H19I and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-(iodomethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(iodomethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 2763008 |
| Molecular Formula | C11H19I |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-(iodomethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | ICC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C11H19I/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h9-11H,1-8H2 |
| InChIKey | ADYQLAVZKBOMMR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|