About methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate
methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate (PubChem CID 2763199) has the molecular formula C6H6ClNO3
and a molecular weight of 175.57 g/mol. Its IUPAC name is methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate |
| PubChem CID | 2763199 |
| Molecular Formula | C6H6ClNO3 |
| Molecular Weight | 175.57 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(CCl)n1 |
| InChI | InChI=1S/C6H6ClNO3/c1-10-6(9)4-3-11-5(2-7)8-4/h3H,2H2,1H3 |
| InChIKey | CMUKPCIZFMTLKD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.57 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate (CID 2763199) is methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate is COC(=O)c1coc(CCl)n1.
What is the InChIKey of methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate?
The InChIKey is CMUKPCIZFMTLKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO3/c1-10-6(9)4-3-11-5(2-7)8-4/h3H,2H2,1H3.
What are the key properties of methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate?
methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate has a molecular weight of 175.57 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(chloromethyl)-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 2763199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).