About 2-bromo-1,3-thiazole-5-carboxylic acid
2-bromo-1,3-thiazole-5-carboxylic acid (PubChem CID 2763210) has the molecular formula C4H2BrNO2S
and a molecular weight of 208.04 g/mol. Its IUPAC name is 2-bromo-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-bromo-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 2763210 |
| Molecular Formula | C4H2BrNO2S |
| Molecular Weight | 208.04 g/mol |
| Exact Mass | 206.90 |
| IUPAC Name | 2-bromo-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Br)s1 |
| InChI | InChI=1S/C4H2BrNO2S/c5-4-6-1-2(9-4)3(7)8/h1H,(H,7,8) |
| InChIKey | BESGTWHUMYHYEQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.04 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-bromo-1,3-thiazole-5-carboxylic acid (CID 2763210) is 2-bromo-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-bromo-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-bromo-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(Br)s1.
What is the InChIKey of 2-bromo-1,3-thiazole-5-carboxylic acid?
The InChIKey is BESGTWHUMYHYEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrNO2S/c5-4-6-1-2(9-4)3(7)8/h1H,(H,7,8).
What are the key properties of 2-bromo-1,3-thiazole-5-carboxylic acid?
2-bromo-1,3-thiazole-5-carboxylic acid has a molecular weight of 208.04 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 2763210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).