About (3-bromo-1,2-oxazol-5-yl)methanamine
(3-bromo-1,2-oxazol-5-yl)methanamine (PubChem CID 2763221) has the molecular formula C4H5BrN2O
and a molecular weight of 177.00 g/mol. Its IUPAC name is (3-bromo-1,2-oxazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (3-bromo-1,2-oxazol-5-yl)methanamine |
| PubChem CID | 2763221 |
| Molecular Formula | C4H5BrN2O |
| Molecular Weight | 177.00 g/mol |
| Exact Mass | 175.96 |
| IUPAC Name | (3-bromo-1,2-oxazol-5-yl)methanamine |
| SMILES | NCc1cc(Br)no1 |
| InChI | InChI=1S/C4H5BrN2O/c5-4-1-3(2-6)8-7-4/h1H,2,6H2 |
| InChIKey | LCFSQWLCIUITOH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.00 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-bromo-1,2-oxazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-1,2-oxazol-5-yl)methanamine?
The IUPAC name of (3-bromo-1,2-oxazol-5-yl)methanamine (CID 2763221) is (3-bromo-1,2-oxazol-5-yl)methanamine.
What is the SMILES notation for (3-bromo-1,2-oxazol-5-yl)methanamine?
The canonical SMILES for (3-bromo-1,2-oxazol-5-yl)methanamine is NCc1cc(Br)no1.
What is the InChIKey of (3-bromo-1,2-oxazol-5-yl)methanamine?
The InChIKey is LCFSQWLCIUITOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BrN2O/c5-4-1-3(2-6)8-7-4/h1H,2,6H2.
What are the key properties of (3-bromo-1,2-oxazol-5-yl)methanamine?
(3-bromo-1,2-oxazol-5-yl)methanamine has a molecular weight of 177.00 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-1,2-oxazol-5-yl)methanamine is sourced from PubChem (CID 2763221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).