About tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane
tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane (PubChem CID 2763253) has the molecular formula C15H31N3Sn
and a molecular weight of 372.15 g/mol. Its IUPAC name is tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane.
Molecular Properties
| Compound Name | tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane |
| PubChem CID | 2763253 |
| Molecular Formula | C15H31N3Sn |
| Molecular Weight | 372.15 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ncnn1C |
| InChI | InChI=1S/3C4H9.C3H4N3.Sn/c3*1-3-4-2;1-6-3-4-2-5-6;/h3*1,3-4H2,2H3;2H,1H3; |
| InChIKey | KZBBXMWBVDNMND-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.15 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane?
The IUPAC name of tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane (CID 2763253) is tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane.
What is the SMILES notation for tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane?
The canonical SMILES for tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane is CCCC[Sn](CCCC)(CCCC)c1ncnn1C.
What is the InChIKey of tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane?
The InChIKey is KZBBXMWBVDNMND-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.C3H4N3.Sn/c3*1-3-4-2;1-6-3-4-2-5-6;/h3*1,3-4H2,2H3;2H,1H3;.
What are the key properties of tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane?
tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane has a molecular weight of 372.15 g/mol, XLogP of 3.87, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(2-methyl-1,2,4-triazol-3-yl)stannane is sourced from PubChem (CID 2763253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).