About ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate
ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate (PubChem CID 2763256) has the molecular formula C18H33NO3Sn
and a molecular weight of 430.18 g/mol. Its IUPAC name is ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate |
| PubChem CID | 2763256 |
| Molecular Formula | C18H33NO3Sn |
| Molecular Weight | 430.18 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(C(=O)OCC)no1 |
| InChI | InChI=1S/C6H6NO3.3C4H9.Sn/c1-2-9-6(8)5-3-4-10-7-5;3*1-3-4-2;/h3H,2H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | LDFBGRFJCWKQCA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.18 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate (CID 2763256) is ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate is CCCC[Sn](CCCC)(CCCC)c1cc(C(=O)OCC)no1.
What is the InChIKey of ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate?
The InChIKey is LDFBGRFJCWKQCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6NO3.3C4H9.Sn/c1-2-9-6(8)5-3-4-10-7-5;3*1-3-4-2;/h3H,2H2,1H3;3*1,3-4H2,2H3;.
What are the key properties of ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate?
ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate has a molecular weight of 430.18 g/mol, XLogP of 4.91, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-tributylstannyl-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 2763256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).