About tributyl(1,3-thiazol-2-yl)stannane
tributyl(1,3-thiazol-2-yl)stannane (PubChem CID 2763259) has the molecular formula C15H29NSSn
and a molecular weight of 374.18 g/mol. Its IUPAC name is tributyl(1,3-thiazol-2-yl)stannane.
Molecular Properties
| Compound Name | tributyl(1,3-thiazol-2-yl)stannane |
| PubChem CID | 2763259 |
| Molecular Formula | C15H29NSSn |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | tributyl(1,3-thiazol-2-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1nccs1 |
| InChI | InChI=1S/3C4H9.C3H2NS.Sn/c3*1-3-4-2;1-2-5-3-4-1;/h3*1,3-4H2,2H3;1-2H; |
| InChIKey | WUOFQGMXQCSPPV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tributyl(1,3-thiazol-2-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(1,3-thiazol-2-yl)stannane?
The IUPAC name of tributyl(1,3-thiazol-2-yl)stannane (CID 2763259) is tributyl(1,3-thiazol-2-yl)stannane.
What is the SMILES notation for tributyl(1,3-thiazol-2-yl)stannane?
The canonical SMILES for tributyl(1,3-thiazol-2-yl)stannane is CCCC[Sn](CCCC)(CCCC)c1nccs1.
What is the InChIKey of tributyl(1,3-thiazol-2-yl)stannane?
The InChIKey is WUOFQGMXQCSPPV-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.C3H2NS.Sn/c3*1-3-4-2;1-2-5-3-4-1;/h3*1,3-4H2,2H3;1-2H;.
What are the key properties of tributyl(1,3-thiazol-2-yl)stannane?
tributyl(1,3-thiazol-2-yl)stannane has a molecular weight of 374.18 g/mol, XLogP of 5.20, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(1,3-thiazol-2-yl)stannane is sourced from PubChem (CID 2763259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).