About [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol
[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol (PubChem CID 2763407) has the molecular formula C9H7ClN2O2
and a molecular weight of 210.62 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol |
| PubChem CID | 2763407 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol |
| SMILES | OCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C9H7ClN2O2/c10-7-3-1-6(2-4-7)9-11-8(5-13)14-12-9/h1-4,13H,5H2 |
| InChIKey | SNHGRCYDLKXNSH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol?
The IUPAC name of [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol (CID 2763407) is [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol.
What is the SMILES notation for [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol?
The canonical SMILES for [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol is OCc1nc(-c2ccc(Cl)cc2)no1.
What is the InChIKey of [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol?
The InChIKey is SNHGRCYDLKXNSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O2/c10-7-3-1-6(2-4-7)9-11-8(5-13)14-12-9/h1-4,13H,5H2.
What are the key properties of [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol?
[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol has a molecular weight of 210.62 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methanol is sourced from PubChem (CID 2763407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).